C23H32O4 — CID 167210425
3-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-2,4-dihydroxy-6-pentylbenzoic acid (PubChem CID 167210425) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-2,4-dihydroxy-6-pentylbenzoic acid.
| Compound Name | 3-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-2,4-dihydroxy-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 167210425 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-2,4-dihydroxy-6-pentylbenzoic acid |
| SMILES | C=C(C)[C@]1(C)CCC(C)=CC1c1c(O)cc(CCCCC)c(C(=O)O)c1O |
| InChI | InChI=1S/C23H32O4/c1-6-7-8-9-16-13-18(24)20(21(25)19(16)22(26)27)17-12-15(4)10-11-23(17,5)14(2)3/h12-13,17,24-25H,2,6-11H2,1,3-5H3,(H,26,27)/t17?,23-/m0/s1 |
| InChIKey | AUCYOGYNGMKWSH-VXLWULRPSA-N |
| XLogP | 5.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|