C24H34O3 — CID 155748548
[2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] acetate (PubChem CID 155748548) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is [2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] acetate.
| Compound Name | [2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] acetate |
|---|---|
| PubChem CID | 155748548 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] acetate |
| SMILES | C=C(C)C1(C)CCC(C)=CC1c1c(O)cc(CCCCC)cc1OC(C)=O |
| InChI | InChI=1S/C24H34O3/c1-7-8-9-10-19-14-21(26)23(22(15-19)27-18(5)25)20-13-17(4)11-12-24(20,6)16(2)3/h13-15,20,26H,2,7-12H2,1,3-6H3 |
| InChIKey | VPUOTVWNRKCSCQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|