C20H28O2 — CID 167210181
2-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol (PubChem CID 167210181) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol.
| Compound Name | 2-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol |
|---|---|
| PubChem CID | 167210181 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-[(6R)-3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol |
| SMILES | C=C(C)[C@]1(C)CCC(C)=CC1c1c(O)cc(CCC)cc1O |
| InChI | InChI=1S/C20H28O2/c1-6-7-15-11-17(21)19(18(22)12-15)16-10-14(4)8-9-20(16,5)13(2)3/h10-12,16,21-22H,2,6-9H2,1,3-5H3/t16?,20-/m0/s1 |
| InChIKey | LLNOQLIHTAGSTK-FZCLLLDFSA-N |
| XLogP | 5.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|