C31H48O7 — CID 91185282
[2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetate (PubChem CID 91185282) has the molecular formula C31H48O7 and a molecular weight of 532.72 g/mol. Its IUPAC name is [2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetate.
| Compound Name | [2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 91185282 |
| Molecular Formula | C31H48O7 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | [2-(3,6-dimethyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenyl] 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetate |
| SMILES | C=C(C)C1(C)CCC(C)=CC1c1c(O)cc(CCCCC)cc1OC(=O)COCCOCCOCCOC |
| InChI | InChI=1S/C31H48O7/c1-7-8-9-10-25-20-27(32)30(26-19-24(4)11-12-31(26,5)23(2)3)28(21-25)38-29(33)22-37-18-17-36-16-15-35-14-13-34-6/h19-21,26,32H,2,7-18,22H2,1,3-6H3 |
| InChIKey | KNLVFMDAONDNGE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|