C20H25NO4 — CID 166714687
6-butyl-3-[(3S,4S)-2,6-dimethyl-1-azaspiro[2.5]octa-1,5-dien-4-yl]-2,4-dihydroxybenzoic acid (PubChem CID 166714687) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 6-butyl-3-[(3S,4S)-2,6-dimethyl-1-azaspiro[2.5]octa-1,5-dien-4-yl]-2,4-dihydroxybenzoic acid.
| Compound Name | 6-butyl-3-[(3S,4S)-2,6-dimethyl-1-azaspiro[2.5]octa-1,5-dien-4-yl]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 166714687 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 6-butyl-3-[(3S,4S)-2,6-dimethyl-1-azaspiro[2.5]octa-1,5-dien-4-yl]-2,4-dihydroxybenzoic acid |
| SMILES | CCCCc1cc(O)c([C@@H]2C=C(C)CC[C@]23N=C3C)c(O)c1C(=O)O |
| InChI | InChI=1S/C20H25NO4/c1-4-5-6-13-10-15(22)17(18(23)16(13)19(24)25)14-9-11(2)7-8-20(14)12(3)21-20/h9-10,14,22-23H,4-8H2,1-3H3,(H,24,25)/t14-,20+/m0/s1 |
| InChIKey | DRKADJSYGIKHDP-VBKZILBWSA-N |
| XLogP | 4.18 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|