C18H26O2 — CID 170366594
5-ethyl-2-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzene-1,3-diol (PubChem CID 170366594) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 5-ethyl-2-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzene-1,3-diol.
| Compound Name | 5-ethyl-2-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 170366594 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5-ethyl-2-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzene-1,3-diol |
| SMILES | CCc1cc(O)c(CC2=C(C)CC(C)(C)CC2)c(O)c1 |
| InChI | InChI=1S/C18H26O2/c1-5-13-8-16(19)15(17(20)9-13)10-14-6-7-18(3,4)11-12(14)2/h8-9,19-20H,5-7,10-11H2,1-4H3 |
| InChIKey | VEDIKTLNIKNHGS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|