C25H28O5 — CID 170366809
4-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]benzoic acid (PubChem CID 170366809) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]benzoic acid.
| Compound Name | 4-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 170366809 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]benzoic acid |
| SMILES | CC1=C(COc2cc(O)cc(/C=C/c3ccc(O)cc3)c2C(=O)O)CCC(C)(C)C1 |
| InChI | InChI=1S/C25H28O5/c1-16-14-25(2,3)11-10-19(16)15-30-22-13-21(27)12-18(23(22)24(28)29)7-4-17-5-8-20(26)9-6-17/h4-9,12-13,26-27H,10-11,14-15H2,1-3H3,(H,28,29)/b7-4+ |
| InChIKey | ICOGKUUQQMRNII-QPJJXVBHSA-N |
| XLogP | 5.87 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|