C25H26O6 — CID 170366896
2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]chromen-4-one (PubChem CID 170366896) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]chromen-4-one |
|---|---|
| PubChem CID | 170366896 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2,4,4-trimethylcyclohexen-1-yl)methoxy]chromen-4-one |
| SMILES | CC1=C(COc2cc(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c23)CCC(C)(C)C1 |
| InChI | InChI=1S/C25H26O6/c1-14-12-25(2,3)7-6-16(14)13-30-22-9-17(26)10-23-24(22)20(29)11-21(31-23)15-4-5-18(27)19(28)8-15/h4-5,8-11,26-28H,6-7,12-13H2,1-3H3 |
| InChIKey | JCFARSKJKVAJBT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|