C20H18O10 — CID 162973817
5,7-dihydroxy-2-[4-hydroxy-3-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]chromen-4-one (PubChem CID 162973817) has the molecular formula C20H18O10 and a molecular weight of 418.35 g/mol. Its IUPAC name is 5,7-dihydroxy-2-[4-hydroxy-3-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-[4-hydroxy-3-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]chromen-4-one |
|---|---|
| PubChem CID | 162973817 |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 5,7-dihydroxy-2-[4-hydroxy-3-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(O[C@@H]3OC[C@H](O)[C@@H](O)[C@H]3O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C20H18O10/c21-9-4-11(23)17-12(24)6-14(29-16(17)5-9)8-1-2-10(22)15(3-8)30-20-19(27)18(26)13(25)7-28-20/h1-6,13,18-23,25-27H,7H2/t13-,18+,19+,20-/m0/s1 |
| InChIKey | ZUMPYZVELBOZDM-HAEOHBJNSA-N |
| XLogP | 0.39 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |