C25H26O15 — CID 59991321
2-(3,4-dihydroxyphenyl)-7-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxychromen-4-one (PubChem CID 59991321) has the molecular formula C25H26O15 and a molecular weight of 566.47 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-7-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-7-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 59991321 |
| Molecular Formula | C25H26O15 |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-7-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxychromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC[C@@H](O)C(O)[C@H]3O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c(O)c(O)c12 |
| InChI | InChI=1S/C25H26O15/c26-9-2-1-8(3-10(9)27)14-4-11(28)17-15(38-14)5-16(20(33)21(17)34)39-25-23(19(32)13(30)7-37-25)40-24-22(35)18(31)12(29)6-36-24/h1-5,12-13,18-19,22-27,29-35H,6-7H2/t12-,13-,18+,19?,22-,23-,24+,25+/m1/s1 |
| InChIKey | DBKLYDRODYBAGT-HNTZEXQXSA-N |
| XLogP | -1.44 |
| TPSA | 249.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|