C20H18O11 — CID 162903938
2-[4,5-dihydroxy-2-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one (PubChem CID 162903938) has the molecular formula C20H18O11 and a molecular weight of 434.35 g/mol. Its IUPAC name is 2-[4,5-dihydroxy-2-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one.
| Compound Name | 2-[4,5-dihydroxy-2-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 162903938 |
| Molecular Formula | C20H18O11 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[4,5-dihydroxy-2-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5,7-dihydroxychromen-4-one |
| SMILES | O=c1cc(-c2cc(O)c(O)cc2O[C@H]2OC[C@@H](O)[C@@H](O)[C@@H]2O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C20H18O11/c21-7-1-11(24)17-12(25)5-14(30-16(17)2-7)8-3-9(22)10(23)4-15(8)31-20-19(28)18(27)13(26)6-29-20/h1-5,13,18-24,26-28H,6H2/t13-,18-,19+,20-/m1/s1 |
| InChIKey | KDJLAZUNMUDLGA-NWTFUFRBSA-N |
| XLogP | 0.10 |
| TPSA | 190.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|