C25H26N2O5 — CID 158485368
4-ethoxy-2-methylbenzene-1,3-dicarboxylic acid;4-(2-phenylethenyl)benzene-1,2-diamine (PubChem CID 158485368) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-ethoxy-2-methylbenzene-1,3-dicarboxylic acid;4-(2-phenylethenyl)benzene-1,2-diamine.
| Compound Name | 4-ethoxy-2-methylbenzene-1,3-dicarboxylic acid;4-(2-phenylethenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 158485368 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-ethoxy-2-methylbenzene-1,3-dicarboxylic acid;4-(2-phenylethenyl)benzene-1,2-diamine |
| SMILES | CCOc1ccc(C(=O)O)c(C)c1C(=O)O.Nc1ccc(C=Cc2ccccc2)cc1N |
| InChI | InChI=1S/C14H14N2.C11H12O5/c15-13-9-8-12(10-14(13)16)7-6-11-4-2-1-3-5-11;1-3-16-8-5-4-7(10(12)13)6(2)9(8)11(14)15/h1-10H,15-16H2;4-5H,3H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | HIAKIDWOLZIDSF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|