C11H14O3 — CID 131973876
1-(2,4-dihydroxy-6-propylphenyl)ethanone (PubChem CID 131973876) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-6-propylphenyl)ethanone.
| Compound Name | 1-(2,4-dihydroxy-6-propylphenyl)ethanone |
|---|---|
| PubChem CID | 131973876 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(2,4-dihydroxy-6-propylphenyl)ethanone |
| SMILES | CCCc1cc(O)cc(O)c1C(C)=O |
| InChI | InChI=1S/C11H14O3/c1-3-4-8-5-9(13)6-10(14)11(8)7(2)12/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | FEEOESQZERTZAT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |