C13H19NO4 — CID 14837586
N-hexyl-2,4,6-trihydroxybenzamide (PubChem CID 14837586) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-hexyl-2,4,6-trihydroxybenzamide.
| Compound Name | N-hexyl-2,4,6-trihydroxybenzamide |
|---|---|
| PubChem CID | 14837586 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-hexyl-2,4,6-trihydroxybenzamide |
| SMILES | CCCCCCNC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C13H19NO4/c1-2-3-4-5-6-14-13(18)12-10(16)7-9(15)8-11(12)17/h7-8,15-17H,2-6H2,1H3,(H,14,18) |
| InChIKey | ZNQZQGJQFWARPF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|