2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid

C16H22O5 — CID 10589878

IUPAC2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid
SMILESCCCCCCCC(=O)c1c(O)cc(O)cc1CC(=O)O
InChIInChI=1S/C16H22O5/c1-2-3-4-5-6-7-13(18)16-11(9-15(20)21)8-12(17)10-14(16)19/h8,10,17,19H,2-7,9H2,1H3,(H,20,21)
InChIKeyNBOKSRGCFZKGBA-UHFFFAOYSA-N
MW294.35 g/mol
LogP3.27
Rot. Bonds9

About 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid

2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid (PubChem CID 10589878) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid.

Molecular Properties

Compound Name2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid
PubChem CID10589878
Molecular FormulaC16H22O5
Molecular Weight294.35 g/mol
Exact Mass294.15
IUPAC Name2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid
SMILESCCCCCCCC(=O)c1c(O)cc(O)cc1CC(=O)O
InChIInChI=1S/C16H22O5/c1-2-3-4-5-6-7-13(18)16-11(9-15(20)21)8-12(17)10-14(16)19/h8,10,17,19H,2-7,9H2,1H3,(H,20,21)
InChIKeyNBOKSRGCFZKGBA-UHFFFAOYSA-N
XLogP3.27
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.35
LogP ≤ 53.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid?
The IUPAC name of 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid (CID 10589878) is 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid.
What is the SMILES notation for 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid?
The canonical SMILES for 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid is CCCCCCCC(=O)c1c(O)cc(O)cc1CC(=O)O.
What is the InChIKey of 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid?
The InChIKey is NBOKSRGCFZKGBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5/c1-2-3-4-5-6-7-13(18)16-11(9-15(20)21)8-12(17)10-14(16)19/h8,10,17,19H,2-7,9H2,1H3,(H,20,21).
What are the key properties of 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid?
2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid has a molecular weight of 294.35 g/mol, XLogP of 3.27, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid is sourced from PubChem (CID 10589878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).