C16H22O5 — CID 10589878
2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid (PubChem CID 10589878) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid.
| Compound Name | 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid |
|---|---|
| PubChem CID | 10589878 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(3,5-dihydroxy-2-octanoylphenyl)acetic acid |
| SMILES | CCCCCCCC(=O)c1c(O)cc(O)cc1CC(=O)O |
| InChI | InChI=1S/C16H22O5/c1-2-3-4-5-6-7-13(18)16-11(9-15(20)21)8-12(17)10-14(16)19/h8,10,17,19H,2-7,9H2,1H3,(H,20,21) |
| InChIKey | NBOKSRGCFZKGBA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|