C36H52O12 — CID 139121434
ethyl 2-[3,5-dihydroxy-2-[(6R)-6-hydroxyoctanoyl]phenyl]acetate (PubChem CID 139121434) has the molecular formula C36H52O12 and a molecular weight of 676.80 g/mol. Its IUPAC name is ethyl 2-[3,5-dihydroxy-2-[(6R)-6-hydroxyoctanoyl]phenyl]acetate.
| Compound Name | ethyl 2-[3,5-dihydroxy-2-[(6R)-6-hydroxyoctanoyl]phenyl]acetate |
|---|---|
| PubChem CID | 139121434 |
| Molecular Formula | C36H52O12 |
| Molecular Weight | 676.80 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | ethyl 2-[3,5-dihydroxy-2-[(6R)-6-hydroxyoctanoyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(O)cc(O)c1C(=O)CCCC[C@H](O)CC.CCOC(=O)Cc1cc(O)cc(O)c1C(=O)CCCC[C@H](O)CC |
| InChI | InChI=1S/2C18H26O6/c2*1-3-13(19)7-5-6-8-15(21)18-12(10-17(23)24-4-2)9-14(20)11-16(18)22/h2*9,11,13,19-20,22H,3-8,10H2,1-2H3/t2*13-/m11/s1 |
| InChIKey | CHRPZDQVYQWBJK-DKAPBGRZSA-N |
| XLogP | 5.43 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.80 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|