C17H26O3 — CID 21116378
1-(2,4-dihydroxyphenyl)undecan-2-one (PubChem CID 21116378) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)undecan-2-one.
| Compound Name | 1-(2,4-dihydroxyphenyl)undecan-2-one |
|---|---|
| PubChem CID | 21116378 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)undecan-2-one |
| SMILES | CCCCCCCCCC(=O)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C17H26O3/c1-2-3-4-5-6-7-8-9-15(18)12-14-10-11-16(19)13-17(14)20/h10-11,13,19-20H,2-9,12H2,1H3 |
| InChIKey | ZCDLYKFRHUMMOU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|