C22H34O4 — CID 174952573
bis(3-methylbutyl) 3,4-diethylbenzene-1,2-dicarboxylate (PubChem CID 174952573) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is bis(3-methylbutyl) 3,4-diethylbenzene-1,2-dicarboxylate.
| Compound Name | bis(3-methylbutyl) 3,4-diethylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174952573 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | bis(3-methylbutyl) 3,4-diethylbenzene-1,2-dicarboxylate |
| SMILES | CCc1ccc(C(=O)OCCC(C)C)c(C(=O)OCCC(C)C)c1CC |
| InChI | InChI=1S/C22H34O4/c1-7-17-9-10-19(21(23)25-13-11-15(3)4)20(18(17)8-2)22(24)26-14-12-16(5)6/h9-10,15-16H,7-8,11-14H2,1-6H3 |
| InChIKey | WDFSVCMSRIXABH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |