C14H18O6 — CID 87733467
dimethyl 3,4-diethylbenzene-1,2-dicarboperoxoate (PubChem CID 87733467) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is dimethyl 3,4-diethylbenzene-1,2-dicarboperoxoate.
| Compound Name | dimethyl 3,4-diethylbenzene-1,2-dicarboperoxoate |
|---|---|
| PubChem CID | 87733467 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | dimethyl 3,4-diethylbenzene-1,2-dicarboperoxoate |
| SMILES | CCc1ccc(C(=O)OOC)c(C(=O)OOC)c1CC |
| InChI | InChI=1S/C14H18O6/c1-5-9-7-8-11(13(15)19-17-3)12(10(9)6-2)14(16)20-18-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | XIYWCNSJKRISRE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|