C24H34N2O2 — CID 174760493
2,3-diethyl-6-methylbenzamide (PubChem CID 174760493) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2,3-diethyl-6-methylbenzamide.
| Compound Name | 2,3-diethyl-6-methylbenzamide |
|---|---|
| PubChem CID | 174760493 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 2,3-diethyl-6-methylbenzamide |
| SMILES | CCc1ccc(C)c(C(N)=O)c1CC.CCc1ccc(C)c(C(N)=O)c1CC |
| InChI | InChI=1S/2C12H17NO/c2*1-4-9-7-6-8(3)11(12(13)14)10(9)5-2/h2*6-7H,4-5H2,1-3H3,(H2,13,14) |
| InChIKey | QVLBHHUZGKGIBB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |