C17H26O4S — CID 69303394
bis(3-methylbutyl) 2-methylthiophene-3,4-dicarboxylate (PubChem CID 69303394) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is bis(3-methylbutyl) 2-methylthiophene-3,4-dicarboxylate.
| Compound Name | bis(3-methylbutyl) 2-methylthiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 69303394 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | bis(3-methylbutyl) 2-methylthiophene-3,4-dicarboxylate |
| SMILES | Cc1scc(C(=O)OCCC(C)C)c1C(=O)OCCC(C)C |
| InChI | InChI=1S/C17H26O4S/c1-11(2)6-8-20-16(18)14-10-22-13(5)15(14)17(19)21-9-7-12(3)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | XUWRZUMVXYAEBY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |