C17H26O4S — CID 140513739
bis(2,2-dimethylpropyl) 2-methylthiophene-3,4-dicarboxylate (PubChem CID 140513739) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-methylthiophene-3,4-dicarboxylate.
| Compound Name | bis(2,2-dimethylpropyl) 2-methylthiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 140513739 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-methylthiophene-3,4-dicarboxylate |
| SMILES | Cc1scc(C(=O)OCC(C)(C)C)c1C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C17H26O4S/c1-11-13(15(19)21-10-17(5,6)7)12(8-22-11)14(18)20-9-16(2,3)4/h8H,9-10H2,1-7H3 |
| InChIKey | TZELXZFUXYXIID-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |