C14H10ClIN2O3 — CID 118085737
2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetyl iodide (PubChem CID 118085737) has the molecular formula C14H10ClIN2O3 and a molecular weight of 416.60 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetyl iodide.
| Compound Name | 2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetyl iodide |
|---|---|
| PubChem CID | 118085737 |
| Molecular Formula | C14H10ClIN2O3 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetyl iodide |
| SMILES | O=C(I)CNC(=O)c1ncc(-c2cccc(Cl)c2)cc1O |
| InChI | InChI=1S/C14H10ClIN2O3/c15-10-3-1-2-8(4-10)9-5-11(19)13(17-6-9)14(21)18-7-12(16)20/h1-6,19H,7H2,(H,18,21) |
| InChIKey | VOPRPRUQQSBLQF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|