C15H13FN2O3 — CID 158403612
4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanamide (PubChem CID 158403612) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanamide.
| Compound Name | 4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 158403612 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanamide |
| SMILES | NC(=O)CCC(=O)c1ncc(-c2cccc(F)c2)cc1O |
| InChI | InChI=1S/C15H13FN2O3/c16-11-3-1-2-9(6-11)10-7-13(20)15(18-8-10)12(19)4-5-14(17)21/h1-3,6-8,20H,4-5H2,(H2,17,21) |
| InChIKey | GYKFNPQYAJIJMK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |