C16H18FN3O5 — CID 140602466
2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetate;2-hydroxyethylazanium (PubChem CID 140602466) has the molecular formula C16H18FN3O5 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetate;2-hydroxyethylazanium.
| Compound Name | 2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetate;2-hydroxyethylazanium |
|---|---|
| PubChem CID | 140602466 |
| Molecular Formula | C16H18FN3O5 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetate;2-hydroxyethylazanium |
| SMILES | O=C([O-])CNC(=O)c1ncc(-c2cccc(F)c2)cc1O.[NH3+]CCO |
| InChI | InChI=1S/C14H11FN2O4.C2H7NO/c15-10-3-1-2-8(4-10)9-5-11(18)13(16-6-9)14(21)17-7-12(19)20;3-1-2-4/h1-6,18H,7H2,(H,17,21)(H,19,20);4H,1-3H2 |
| InChIKey | LVJZZVFSUVOSNP-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |