C14H11FN2O4 — CID 140848116
2-[deuterio-[3-deuteriooxy-5-(3-fluorophenyl)pyridine-2-carbonyl]amino]acetic acid (PubChem CID 140848116) has the molecular formula C14H11FN2O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-[deuterio-[3-deuteriooxy-5-(3-fluorophenyl)pyridine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[deuterio-[3-deuteriooxy-5-(3-fluorophenyl)pyridine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 140848116 |
| Molecular Formula | C14H11FN2O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[deuterio-[3-deuteriooxy-5-(3-fluorophenyl)pyridine-2-carbonyl]amino]acetic acid |
| SMILES | [2H]Oc1cc(-c2cccc(F)c2)cnc1C(=O)N([2H])CC(=O)O |
| InChI | InChI=1S/C14H11FN2O4/c15-10-3-1-2-8(4-10)9-5-11(18)13(16-6-9)14(21)17-7-12(19)20/h1-6,18H,7H2,(H,17,21)(H,19,20)/i/hD2 |
| InChIKey | PXWOWORYDKAEJO-ZSJDYOACSA-N |
| XLogP | 1.41 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |