C15H13ClN2O4 — CID 140848117
2-[[5-(5-chloro-2-methylphenyl)-3-hydroxypyridine-2-carbonyl]-deuterioamino]acetic acid (PubChem CID 140848117) has the molecular formula C15H13ClN2O4 and a molecular weight of 321.74 g/mol. Its IUPAC name is 2-[[5-(5-chloro-2-methylphenyl)-3-hydroxypyridine-2-carbonyl]-deuterioamino]acetic acid.
| Compound Name | 2-[[5-(5-chloro-2-methylphenyl)-3-hydroxypyridine-2-carbonyl]-deuterioamino]acetic acid |
|---|---|
| PubChem CID | 140848117 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[[5-(5-chloro-2-methylphenyl)-3-hydroxypyridine-2-carbonyl]-deuterioamino]acetic acid |
| SMILES | [2H]N(CC(=O)O)C(=O)c1ncc(-c2cc(Cl)ccc2C)cc1O |
| InChI | InChI=1S/C15H13ClN2O4/c1-8-2-3-10(16)5-11(8)9-4-12(19)14(17-6-9)15(22)18-7-13(20)21/h2-6,19H,7H2,1H3,(H,18,22)(H,20,21)/i/hD |
| InChIKey | XFZFCHHQSHMUBB-DYCDLGHISA-N |
| XLogP | 2.23 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |