C16H15FN2O3 — CID 160943915
4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-N-methyl-4-oxobutanamide (PubChem CID 160943915) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-N-methyl-4-oxobutanamide.
| Compound Name | 4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 160943915 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]-N-methyl-4-oxobutanamide |
| SMILES | CNC(=O)CCC(=O)c1ncc(-c2cccc(F)c2)cc1O |
| InChI | InChI=1S/C16H15FN2O3/c1-18-15(22)6-5-13(20)16-14(21)8-11(9-19-16)10-3-2-4-12(17)7-10/h2-4,7-9,21H,5-6H2,1H3,(H,18,22) |
| InChIKey | UXYPOBJIMRHMNA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |