C15H14FN3O3 — CID 135294730
5-(4-fluorophenyl)-3-hydroxy-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 135294730) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-hydroxy-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-3-hydroxy-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135294730 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 5-(4-fluorophenyl)-3-hydroxy-N-[2-(methylamino)-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | CNC(=O)CNC(=O)c1ncc(-c2ccc(F)cc2)cc1O |
| InChI | InChI=1S/C15H14FN3O3/c1-17-13(21)8-19-15(22)14-12(20)6-10(7-18-14)9-2-4-11(16)5-3-9/h2-7,20H,8H2,1H3,(H,17,21)(H,19,22) |
| InChIKey | ADVVBNKELOSVIY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |