C15H11N3O4 — CID 59513097
2-[[3-hydroxy-5-(4-isocyanophenyl)pyridine-2-carbonyl]amino]acetic acid (PubChem CID 59513097) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-[[3-hydroxy-5-(4-isocyanophenyl)pyridine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[3-hydroxy-5-(4-isocyanophenyl)pyridine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 59513097 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[[3-hydroxy-5-(4-isocyanophenyl)pyridine-2-carbonyl]amino]acetic acid |
| SMILES | [C-]#[N+]c1ccc(-c2cnc(C(=O)NCC(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C15H11N3O4/c1-16-11-4-2-9(3-5-11)10-6-12(19)14(17-7-10)15(22)18-8-13(20)21/h2-7,19H,8H2,(H,18,22)(H,20,21) |
| InChIKey | WESRXHMJQHLLSE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|