C14H9B2ClN2O4 — CID 145160330
CID 145160330 (PubChem CID 145160330) has the molecular formula C14H9B2ClN2O4 and a molecular weight of 326.31 g/mol.
| Compound Name | CID 145160330 |
|---|---|
| PubChem CID | 145160330 |
| Molecular Formula | C14H9B2ClN2O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2cnc(C(=O)NCC(=O)O)c(O)c2)cc(Cl)c1[B] |
| InChI | InChI=1S/C14H9B2ClN2O4/c15-8-1-6(2-9(17)12(8)16)7-3-10(20)13(18-4-7)14(23)19-5-11(21)22/h1-4,20H,5H2,(H,19,23)(H,21,22) |
| InChIKey | ALGTWXXTGPLPQO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|