C20H26FN3O7 — CID 172862946
2-[bis(2-hydroxyethyl)amino]ethanol;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate (PubChem CID 172862946) has the molecular formula C20H26FN3O7 and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 172862946 |
| Molecular Formula | C20H26FN3O7 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)c1ncc(-c2cccc(F)c2)cc1O.OCCN(CCO)CCO |
| InChI | InChI=1S/C14H11FN2O4.C6H15NO3/c1-8(18)21-17-14(20)13-12(19)6-10(7-16-13)9-3-2-4-11(15)5-9;8-4-1-7(2-5-9)3-6-10/h2-7,19H,1H3,(H,17,20);8-10H,1-6H2 |
| InChIKey | ZPHFTZVKKOUPKU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|