C19H24FN3O4 — CID 172856144
N-ethyl-N-methylethanamine;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate (PubChem CID 172856144) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is N-ethyl-N-methylethanamine;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate.
| Compound Name | N-ethyl-N-methylethanamine;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 172856144 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | N-ethyl-N-methylethanamine;[[5-(3-fluorophenyl)-3-hydroxypyridine-2-carbonyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)c1ncc(-c2cccc(F)c2)cc1O.CCN(C)CC |
| InChI | InChI=1S/C14H11FN2O4.C5H13N/c1-8(18)21-17-14(20)13-12(19)6-10(7-16-13)9-3-2-4-11(15)5-9;1-4-6(3)5-2/h2-7,19H,1H3,(H,17,20);4-5H2,1-3H3 |
| InChIKey | YSRYCHAVFUKROH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|