C12H6F3NO2 — CID 90044045
3-(2,5-difluorophenyl)-5-fluoropyridine-2-carboxylic acid (PubChem CID 90044045) has the molecular formula C12H6F3NO2 and a molecular weight of 253.18 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-5-fluoropyridine-2-carboxylic acid.
| Compound Name | 3-(2,5-difluorophenyl)-5-fluoropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 90044045 |
| Molecular Formula | C12H6F3NO2 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-(2,5-difluorophenyl)-5-fluoropyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(F)cc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C12H6F3NO2/c13-6-1-2-10(15)8(3-6)9-4-7(14)5-16-11(9)12(17)18/h1-5H,(H,17,18) |
| InChIKey | DVJJUOPEEMUBMB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |