C15H7Cl2NO3S — CID 18516266
4-(2,4-dichlorophenyl)-2-formylthieno[2,3-c]pyridine-7-carboxylic acid (PubChem CID 18516266) has the molecular formula C15H7Cl2NO3S and a molecular weight of 352.20 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-formylthieno[2,3-c]pyridine-7-carboxylic acid.
| Compound Name | 4-(2,4-dichlorophenyl)-2-formylthieno[2,3-c]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 18516266 |
| Molecular Formula | C15H7Cl2NO3S |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-formylthieno[2,3-c]pyridine-7-carboxylic acid |
| SMILES | O=Cc1cc2c(-c3ccc(Cl)cc3Cl)cnc(C(=O)O)c2s1 |
| InChI | InChI=1S/C15H7Cl2NO3S/c16-7-1-2-9(12(17)3-7)11-5-18-13(15(20)21)14-10(11)4-8(6-19)22-14/h1-6H,(H,20,21) |
| InChIKey | NKGQEDSZTVPXSP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|