C10H4BrCl2NO2S — CID 58094854
2-bromo-4-(2,4-dichlorophenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 58094854) has the molecular formula C10H4BrCl2NO2S and a molecular weight of 353.02 g/mol. Its IUPAC name is 2-bromo-4-(2,4-dichlorophenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-bromo-4-(2,4-dichlorophenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58094854 |
| Molecular Formula | C10H4BrCl2NO2S |
| Molecular Weight | 353.02 g/mol |
| Exact Mass | 350.85 |
| IUPAC Name | 2-bromo-4-(2,4-dichlorophenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(Br)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H4BrCl2NO2S/c11-10-14-7(8(17-10)9(15)16)5-2-1-4(12)3-6(5)13/h1-3H,(H,15,16) |
| InChIKey | WPXRMMKVQYTURW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.02 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |