About 2-bromobenzenethiol;zinc
2-bromobenzenethiol;zinc (PubChem CID 158336456) has the molecular formula C6H5BrSZn
and a molecular weight of 254.47 g/mol. Its IUPAC name is 2-bromobenzenethiol;zinc.
Molecular Properties
| Compound Name | 2-bromobenzenethiol;zinc |
| PubChem CID | 158336456 |
| Molecular Formula | C6H5BrSZn |
| Molecular Weight | 254.47 g/mol |
| Exact Mass | 251.86 |
| IUPAC Name | 2-bromobenzenethiol;zinc |
| SMILES | Sc1ccccc1Br.[Zn] |
| InChI | InChI=1S/C6H5BrS.Zn/c7-5-3-1-2-4-6(5)8;/h1-4,8H; |
| InChIKey | GQQIBRJMJNAWRD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobenzenethiol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzenethiol;zinc?
The IUPAC name of 2-bromobenzenethiol;zinc (CID 158336456) is 2-bromobenzenethiol;zinc.
What is the SMILES notation for 2-bromobenzenethiol;zinc?
The canonical SMILES for 2-bromobenzenethiol;zinc is Sc1ccccc1Br.[Zn].
What is the InChIKey of 2-bromobenzenethiol;zinc?
The InChIKey is GQQIBRJMJNAWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrS.Zn/c7-5-3-1-2-4-6(5)8;/h1-4,8H;.
What are the key properties of 2-bromobenzenethiol;zinc?
2-bromobenzenethiol;zinc has a molecular weight of 254.47 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzenethiol;zinc is sourced from PubChem (CID 158336456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).