C6H5BrS — CID 71309862
6-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-thiol (PubChem CID 71309862) has the molecular formula C6H5BrS and a molecular weight of 195.03 g/mol. Its IUPAC name is 6-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-thiol.
| Compound Name | 6-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-thiol |
|---|---|
| PubChem CID | 71309862 |
| Molecular Formula | C6H5BrS |
| Molecular Weight | 195.03 g/mol |
| Exact Mass | 193.95 |
| IUPAC Name | 6-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-thiol |
| SMILES | S[13c]1[13cH][13cH][13cH][13cH][13c]1Br |
| InChI | InChI=1S/C6H5BrS/c7-5-3-1-2-4-6(5)8/h1-4,8H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | YUQUNWNSQDULTI-IDEBNGHGSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.03 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|