About CID 59369489
CID 59369489 (PubChem CID 59369489) has the molecular formula C7H5Br
and a molecular weight of 169.02 g/mol.
Molecular Properties
| Compound Name | CID 59369489 |
| PubChem CID | 59369489 |
| Molecular Formula | C7H5Br |
| Molecular Weight | 169.02 g/mol |
| Exact Mass | 167.96 |
| IUPAC Name | — |
| SMILES | [CH]c1ccccc1Br |
| InChI | InChI=1S/C7H5Br/c1-6-4-2-3-5-7(6)8/h1-5H |
| InChIKey | XRCWDWFJKZFGMH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.02 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 59369489 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59369489?
The IUPAC name of CID 59369489 (CID 59369489) is not available.
What is the SMILES notation for CID 59369489?
The canonical SMILES for CID 59369489 is [CH]c1ccccc1Br.
What is the InChIKey of CID 59369489?
The InChIKey is XRCWDWFJKZFGMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br/c1-6-4-2-3-5-7(6)8/h1-5H.
What are the key properties of CID 59369489?
CID 59369489 has a molecular weight of 169.02 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59369489 is sourced from PubChem (CID 59369489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).