About (2-chlorophenyl)azanide
(2-chlorophenyl)azanide (PubChem CID 101489883) has the molecular formula C6H5ClN-
and a molecular weight of 126.57 g/mol. Its IUPAC name is (2-chlorophenyl)azanide.
Molecular Properties
| Compound Name | (2-chlorophenyl)azanide |
| PubChem CID | 101489883 |
| Molecular Formula | C6H5ClN- |
| Molecular Weight | 126.57 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | (2-chlorophenyl)azanide |
| SMILES | [NH-]c1ccccc1Cl |
| InChI | InChI=1S/C6H5ClN/c7-5-3-1-2-4-6(5)8/h1-4,8H/q-1 |
| InChIKey | MTUISJCDOVCUHK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-chlorophenyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)azanide?
The IUPAC name of (2-chlorophenyl)azanide (CID 101489883) is (2-chlorophenyl)azanide.
What is the SMILES notation for (2-chlorophenyl)azanide?
The canonical SMILES for (2-chlorophenyl)azanide is [NH-]c1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)azanide?
The InChIKey is MTUISJCDOVCUHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN/c7-5-3-1-2-4-6(5)8/h1-4,8H/q-1.
What are the key properties of (2-chlorophenyl)azanide?
(2-chlorophenyl)azanide has a molecular weight of 126.57 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)azanide is sourced from PubChem (CID 101489883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).