About (2,3-dichlorophenyl)azanide;platinum
(2,3-dichlorophenyl)azanide;platinum (PubChem CID 174721930) has the molecular formula C6H4Cl2NPt-
and a molecular weight of 356.09 g/mol. Its IUPAC name is (2,3-dichlorophenyl)azanide;platinum.
Molecular Properties
| Compound Name | (2,3-dichlorophenyl)azanide;platinum |
| PubChem CID | 174721930 |
| Molecular Formula | C6H4Cl2NPt- |
| Molecular Weight | 356.09 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | (2,3-dichlorophenyl)azanide;platinum |
| SMILES | [NH-]c1cccc(Cl)c1Cl.[Pt] |
| InChI | InChI=1S/C6H4Cl2N.Pt/c7-4-2-1-3-5(9)6(4)8;/h1-3,9H;/q-1; |
| InChIKey | UVJULVCXZPNJMX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2,3-dichlorophenyl)azanide;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichlorophenyl)azanide;platinum?
The IUPAC name of (2,3-dichlorophenyl)azanide;platinum (CID 174721930) is (2,3-dichlorophenyl)azanide;platinum.
What is the SMILES notation for (2,3-dichlorophenyl)azanide;platinum?
The canonical SMILES for (2,3-dichlorophenyl)azanide;platinum is [NH-]c1cccc(Cl)c1Cl.[Pt].
What is the InChIKey of (2,3-dichlorophenyl)azanide;platinum?
The InChIKey is UVJULVCXZPNJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2N.Pt/c7-4-2-1-3-5(9)6(4)8;/h1-3,9H;/q-1;.
What are the key properties of (2,3-dichlorophenyl)azanide;platinum?
(2,3-dichlorophenyl)azanide;platinum has a molecular weight of 356.09 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichlorophenyl)azanide;platinum is sourced from PubChem (CID 174721930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).