About dilithium;(8-azanidylnaphthalen-1-yl)azanide
dilithium;(8-azanidylnaphthalen-1-yl)azanide (PubChem CID 177408168) has the molecular formula C10H8Li2N2
and a molecular weight of 170.07 g/mol. Its IUPAC name is dilithium;(8-azanidylnaphthalen-1-yl)azanide.
Molecular Properties
| Compound Name | dilithium;(8-azanidylnaphthalen-1-yl)azanide |
| PubChem CID | 177408168 |
| Molecular Formula | C10H8Li2N2 |
| Molecular Weight | 170.07 g/mol |
| Exact Mass | 170.10 |
| IUPAC Name | dilithium;(8-azanidylnaphthalen-1-yl)azanide |
| SMILES | [Li+].[Li+].[NH-]c1cccc2cccc([NH-])c12 |
| InChI | InChI=1S/C10H8N2.2Li/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;;/h1-6,11-12H;;/q-2;2*+1 |
| InChIKey | DVJSYNPWVPXQQH-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.07 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dilithium;(8-azanidylnaphthalen-1-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;(8-azanidylnaphthalen-1-yl)azanide?
The IUPAC name of dilithium;(8-azanidylnaphthalen-1-yl)azanide (CID 177408168) is dilithium;(8-azanidylnaphthalen-1-yl)azanide.
What is the SMILES notation for dilithium;(8-azanidylnaphthalen-1-yl)azanide?
The canonical SMILES for dilithium;(8-azanidylnaphthalen-1-yl)azanide is [Li+].[Li+].[NH-]c1cccc2cccc([NH-])c12.
What is the InChIKey of dilithium;(8-azanidylnaphthalen-1-yl)azanide?
The InChIKey is DVJSYNPWVPXQQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2Li/c11-8-5-1-3-7-4-2-6-9(12)10(7)8;;/h1-6,11-12H;;/q-2;2*+1.
What are the key properties of dilithium;(8-azanidylnaphthalen-1-yl)azanide?
dilithium;(8-azanidylnaphthalen-1-yl)azanide has a molecular weight of 170.07 g/mol, XLogP of -1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;(8-azanidylnaphthalen-1-yl)azanide is sourced from PubChem (CID 177408168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).