C10H8Se2 — CID 5248106
naphthalene-1,8-diselenol (PubChem CID 5248106) has the molecular formula C10H8Se2 and a molecular weight of 286.09 g/mol. Its IUPAC name is naphthalene-1,8-diselenol.
| Compound Name | naphthalene-1,8-diselenol |
|---|---|
| PubChem CID | 5248106 |
| Molecular Formula | C10H8Se2 |
| Molecular Weight | 286.09 g/mol |
| Exact Mass | 287.90 |
| IUPAC Name | naphthalene-1,8-diselenol |
| SMILES | [SeH]c1cccc2cccc([SeH])c12 |
| InChI | InChI=1S/C10H8Se2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H |
| InChIKey | WUVCLRKWFXSCOT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.09 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|