C11H7I — CID 13067294
2-iodotricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene (PubChem CID 13067294) has the molecular formula C11H7I and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-iodotricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene.
| Compound Name | 2-iodotricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene |
|---|---|
| PubChem CID | 13067294 |
| Molecular Formula | C11H7I |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 2-iodotricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene |
| SMILES | IC1c2cccc3cccc1c23 |
| InChI | InChI=1S/C11H7I/c12-11-8-5-1-3-7-4-2-6-9(11)10(7)8/h1-6,11H |
| InChIKey | JZZKVPJRWCUBRJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|