About 8b,12a-dihydrobenzo[e]pyrene
8b,12a-dihydrobenzo[e]pyrene (PubChem CID 168838340) has the molecular formula C20H14
and a molecular weight of 254.33 g/mol. Its IUPAC name is 8b,12a-dihydrobenzo[e]pyrene.
Molecular Properties
| Compound Name | 8b,12a-dihydrobenzo[e]pyrene |
| PubChem CID | 168838340 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 8b,12a-dihydrobenzo[e]pyrene |
| SMILES | C1=CC2c3cccc4ccc5cccc(c5c34)C2C=C1 |
| InChI | InChI=1S/C20H14/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12,15-16H |
| InChIKey | AUWKBOZWOCLVAO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8b,12a-dihydrobenzo[e]pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8b,12a-dihydrobenzo[e]pyrene?
The IUPAC name of 8b,12a-dihydrobenzo[e]pyrene (CID 168838340) is 8b,12a-dihydrobenzo[e]pyrene.
What is the SMILES notation for 8b,12a-dihydrobenzo[e]pyrene?
The canonical SMILES for 8b,12a-dihydrobenzo[e]pyrene is C1=CC2c3cccc4ccc5cccc(c5c34)C2C=C1.
What is the InChIKey of 8b,12a-dihydrobenzo[e]pyrene?
The InChIKey is AUWKBOZWOCLVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12,15-16H.
What are the key properties of 8b,12a-dihydrobenzo[e]pyrene?
8b,12a-dihydrobenzo[e]pyrene has a molecular weight of 254.33 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8b,12a-dihydrobenzo[e]pyrene is sourced from PubChem (CID 168838340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).