C16H11N — CID 76763878
(10R,11S,13R,14S)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carbonitrile (PubChem CID 76763878) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is (10R,11S,13R,14S)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carbonitrile.
| Compound Name | (10R,11S,13R,14S)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carbonitrile |
|---|---|
| PubChem CID | 76763878 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (10R,11S,13R,14S)-pentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene-12-carbonitrile |
| SMILES | N#CC1[C@@H]2[C@H]3c4cccc5cccc(c45)[C@H]3[C@H]12 |
| InChI | InChI=1S/C16H11N/c17-7-11-15-13-9-5-1-3-8-4-2-6-10(12(8)9)14(13)16(11)15/h1-6,11,13-16H/t11?,13-,14+,15+,16- |
| InChIKey | AOLHKABGRNDJLQ-VHKZYAGUSA-N |
| XLogP | 3.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |