C26H20 — CID 95564432
(2S,4S,14S,16R)-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),5,7,9(26),10,12,17,19,21(25),22-decaene (PubChem CID 95564432) has the molecular formula C26H20 and a molecular weight of 332.45 g/mol. Its IUPAC name is (2S,4S,14S,16R)-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),5,7,9(26),10,12,17,19,21(25),22-decaene.
| Compound Name | (2S,4S,14S,16R)-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),5,7,9(26),10,12,17,19,21(25),22-decaene |
|---|---|
| PubChem CID | 95564432 |
| Molecular Formula | C26H20 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2S,4S,14S,16R)-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),5,7,9(26),10,12,17,19,21(25),22-decaene |
| SMILES | c1cc2c3c(cccc3c1)[C@H]1C[C@H]3c4cccc5cccc(c45)[C@H]3C[C@H]21 |
| InChI | InChI=1S/C26H20/c1-5-15-6-2-10-18-22-14-24-20-12-4-8-16-7-3-11-19(26(16)20)23(24)13-21(22)17(9-1)25(15)18/h1-12,21-24H,13-14H2/t21-,22-,23-,24+/m1/s1 |
| InChIKey | UFWHXJPHNAASJP-YCAMKHIRSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |