About (2-benzylphenyl)azanide
(2-benzylphenyl)azanide (PubChem CID 142239074) has the molecular formula C13H12N-
and a molecular weight of 182.25 g/mol. Its IUPAC name is (2-benzylphenyl)azanide.
Molecular Properties
| Compound Name | (2-benzylphenyl)azanide |
| PubChem CID | 142239074 |
| Molecular Formula | C13H12N- |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | (2-benzylphenyl)azanide |
| SMILES | [NH-]c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H12N/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,14H,10H2/q-1 |
| InChIKey | JZORWRGRNFGJPL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-benzylphenyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylphenyl)azanide?
The IUPAC name of (2-benzylphenyl)azanide (CID 142239074) is (2-benzylphenyl)azanide.
What is the SMILES notation for (2-benzylphenyl)azanide?
The canonical SMILES for (2-benzylphenyl)azanide is [NH-]c1ccccc1Cc1ccccc1.
What is the InChIKey of (2-benzylphenyl)azanide?
The InChIKey is JZORWRGRNFGJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,14H,10H2/q-1.
What are the key properties of (2-benzylphenyl)azanide?
(2-benzylphenyl)azanide has a molecular weight of 182.25 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylphenyl)azanide is sourced from PubChem (CID 142239074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).