About (2-acetylphenyl)azanide;actinium
(2-acetylphenyl)azanide;actinium (PubChem CID 23389380) has the molecular formula C8H8AcNO-
and a molecular weight of 361.16 g/mol. Its IUPAC name is (2-acetylphenyl)azanide;actinium.
Molecular Properties
| Compound Name | (2-acetylphenyl)azanide;actinium |
| PubChem CID | 23389380 |
| Molecular Formula | C8H8AcNO- |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2-acetylphenyl)azanide;actinium |
| SMILES | CC(=O)c1ccccc1[NH-].[Ac] |
| InChI | InChI=1S/C8H9NO.Ac/c1-6(10)7-4-2-3-5-8(7)9;/h2-5H,1H3,(H2,9,10);/p-1 |
| InChIKey | SJUVJVPSNNXANQ-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-acetylphenyl)azanide;actinium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl)azanide;actinium?
The IUPAC name of (2-acetylphenyl)azanide;actinium (CID 23389380) is (2-acetylphenyl)azanide;actinium.
What is the SMILES notation for (2-acetylphenyl)azanide;actinium?
The canonical SMILES for (2-acetylphenyl)azanide;actinium is CC(=O)c1ccccc1[NH-].[Ac].
What is the InChIKey of (2-acetylphenyl)azanide;actinium?
The InChIKey is SJUVJVPSNNXANQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO.Ac/c1-6(10)7-4-2-3-5-8(7)9;/h2-5H,1H3,(H2,9,10);/p-1.
What are the key properties of (2-acetylphenyl)azanide;actinium?
(2-acetylphenyl)azanide;actinium has a molecular weight of 361.16 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl)azanide;actinium is sourced from PubChem (CID 23389380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).