C26H27NO3S2 — CID 177487463
[2-(4-dimethylsulfonio-5-oxo-5-phenylpent-1-en-3-yl)phenyl]-(4-methylphenyl)sulfonylazanide (PubChem CID 177487463) has the molecular formula C26H27NO3S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is [2-(4-dimethylsulfonio-5-oxo-5-phenylpent-1-en-3-yl)phenyl]-(4-methylphenyl)sulfonylazanide.
| Compound Name | [2-(4-dimethylsulfonio-5-oxo-5-phenylpent-1-en-3-yl)phenyl]-(4-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 177487463 |
| Molecular Formula | C26H27NO3S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [2-(4-dimethylsulfonio-5-oxo-5-phenylpent-1-en-3-yl)phenyl]-(4-methylphenyl)sulfonylazanide |
| SMILES | C=CC(c1ccccc1[N-]S(=O)(=O)c1ccc(C)cc1)C(C(=O)c1ccccc1)[S+](C)C |
| InChI | InChI=1S/C26H27NO3S2/c1-5-22(26(31(3)4)25(28)20-11-7-6-8-12-20)23-13-9-10-14-24(23)27-32(29,30)21-17-15-19(2)16-18-21/h5-18,22,26H,1H2,2-4H3 |
| InChIKey | OKBQOJVNRONRFV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|